C23H30N2O8 — CID 134609390
2-(hydroxymethyl)-2-[4-(2-methyl-5-nitrophenyl)-6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]propane-1,3-diol (PubChem CID 134609390) has the molecular formula C23H30N2O8 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[4-(2-methyl-5-nitrophenyl)-6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]propane-1,3-diol.
| Compound Name | 2-(hydroxymethyl)-2-[4-(2-methyl-5-nitrophenyl)-6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]propane-1,3-diol |
|---|---|
| PubChem CID | 134609390 |
| Molecular Formula | C23H30N2O8 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-(hydroxymethyl)-2-[4-(2-methyl-5-nitrophenyl)-6-[2-(oxan-2-yloxy)ethoxy]-2-pyridinyl]propane-1,3-diol |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1cc(OCCOC2CCCCO2)nc(C(CO)(CO)CO)c1 |
| InChI | InChI=1S/C23H30N2O8/c1-16-5-6-18(25(29)30)12-19(16)17-10-20(23(13-26,14-27)15-28)24-21(11-17)31-8-9-33-22-4-2-3-7-32-22/h5-6,10-12,22,26-28H,2-4,7-9,13-15H2,1H3 |
| InChIKey | RRZKQDZQEBYJGQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|