C18H20BrN3O2 — CID 99800169
1-(4-bromo-2-pyridinyl)-3-[(4-phenyloxan-4-yl)methyl]urea (PubChem CID 99800169) has the molecular formula C18H20BrN3O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 1-(4-bromo-2-pyridinyl)-3-[(4-phenyloxan-4-yl)methyl]urea.
| Compound Name | 1-(4-bromo-2-pyridinyl)-3-[(4-phenyloxan-4-yl)methyl]urea |
|---|---|
| PubChem CID | 99800169 |
| Molecular Formula | C18H20BrN3O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 1-(4-bromo-2-pyridinyl)-3-[(4-phenyloxan-4-yl)methyl]urea |
| SMILES | O=C(NCC1(c2ccccc2)CCOCC1)Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C18H20BrN3O2/c19-15-6-9-20-16(12-15)22-17(23)21-13-18(7-10-24-11-8-18)14-4-2-1-3-5-14/h1-6,9,12H,7-8,10-11,13H2,(H2,20,21,22,23) |
| InChIKey | WEHNQSUDLWOUFM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |