C13H13BrN4O4 — CID 99800382
N-(4-bromo-2,6-dimethylphenyl)-N'-(2,4-dioxoimidazolidin-1-yl)oxamide (PubChem CID 99800382) has the molecular formula C13H13BrN4O4 and a molecular weight of 369.18 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-N'-(2,4-dioxoimidazolidin-1-yl)oxamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-N'-(2,4-dioxoimidazolidin-1-yl)oxamide |
|---|---|
| PubChem CID | 99800382 |
| Molecular Formula | C13H13BrN4O4 |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-N'-(2,4-dioxoimidazolidin-1-yl)oxamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)C(=O)NN1CC(=O)NC1=O |
| InChI | InChI=1S/C13H13BrN4O4/c1-6-3-8(14)4-7(2)10(6)16-11(20)12(21)17-18-5-9(19)15-13(18)22/h3-4H,5H2,1-2H3,(H,16,20)(H,17,21)(H,15,19,22) |
| InChIKey | NZUXAHIUUFPDOI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|