C24H41N3O4 — CID 99802631
(2S,5R)-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,5-diethyl-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboxamide (PubChem CID 99802631) has the molecular formula C24H41N3O4 and a molecular weight of 435.61 g/mol. Its IUPAC name is (2S,5R)-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,5-diethyl-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboxamide.
| Compound Name | (2S,5R)-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,5-diethyl-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 99802631 |
| Molecular Formula | C24H41N3O4 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (2S,5R)-N-[3-(2-ethoxyethoxymethyl)phenyl]-2,5-diethyl-4-(2-hydroxy-2-methylpropyl)piperazine-1-carboxamide |
| SMILES | CCOCCOCc1cccc(NC(=O)N2C[C@@H](CC)N(CC(C)(C)O)C[C@@H]2CC)c1 |
| InChI | InChI=1S/C24H41N3O4/c1-6-21-16-27(22(7-2)15-26(21)18-24(4,5)29)23(28)25-20-11-9-10-19(14-20)17-31-13-12-30-8-3/h9-11,14,21-22,29H,6-8,12-13,15-18H2,1-5H3,(H,25,28)/t21-,22+/m1/s1 |
| InChIKey | MWMKNYZIZPTRMX-YADHBBJMSA-N |
| XLogP | 3.72 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|