C20H21BrClNO3 — CID 99806002
2-(3-bromophenoxy)-1-[4-[(R)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone (PubChem CID 99806002) has the molecular formula C20H21BrClNO3 and a molecular weight of 438.75 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-1-[4-[(R)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(3-bromophenoxy)-1-[4-[(R)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99806002 |
| Molecular Formula | C20H21BrClNO3 |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-(3-bromophenoxy)-1-[4-[(R)-(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]ethanone |
| SMILES | O=C(COc1cccc(Br)c1)N1CCC([C@@H](O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H21BrClNO3/c21-16-2-1-3-18(12-16)26-13-19(24)23-10-8-15(9-11-23)20(25)14-4-6-17(22)7-5-14/h1-7,12,15,20,25H,8-11,13H2/t20-/m0/s1 |
| InChIKey | LHSQYXVYWBMGEJ-FQEVSTJZSA-N |
| XLogP | 4.45 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |