C23H22N2O3 — CID 99808041
(2S,3S)-N-(2-phenoxy-4-pyridinyl)-2-phenyloxane-3-carboxamide (PubChem CID 99808041) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2S,3S)-N-(2-phenoxy-4-pyridinyl)-2-phenyloxane-3-carboxamide.
| Compound Name | (2S,3S)-N-(2-phenoxy-4-pyridinyl)-2-phenyloxane-3-carboxamide |
|---|---|
| PubChem CID | 99808041 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (2S,3S)-N-(2-phenoxy-4-pyridinyl)-2-phenyloxane-3-carboxamide |
| SMILES | O=C(Nc1ccnc(Oc2ccccc2)c1)[C@H]1CCCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H22N2O3/c26-23(20-12-7-15-27-22(20)17-8-3-1-4-9-17)25-18-13-14-24-21(16-18)28-19-10-5-2-6-11-19/h1-6,8-11,13-14,16,20,22H,7,12,15H2,(H,24,25,26)/t20-,22+/m0/s1 |
| InChIKey | XPCLATSMQPAENO-RBBKRZOGSA-N |
| XLogP | 4.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |