C18H27NO3 — CID 99809914
[(1R)-3,5,5-trimethylcyclohex-2-en-1-yl] (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoate (PubChem CID 99809914) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [(1R)-3,5,5-trimethylcyclohex-2-en-1-yl] (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoate.
| Compound Name | [(1R)-3,5,5-trimethylcyclohex-2-en-1-yl] (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 99809914 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [(1R)-3,5,5-trimethylcyclohex-2-en-1-yl] (2R)-3-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylpropanoate |
| SMILES | CC1=C[C@H](OC(=O)[C@H](C)Cc2c(C)noc2C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H27NO3/c1-11-7-15(10-18(5,6)9-11)21-17(20)12(2)8-16-13(3)19-22-14(16)4/h7,12,15H,8-10H2,1-6H3/t12-,15+/m1/s1 |
| InChIKey | ZMOKDYASOUMMDM-DOMZBBRYSA-N |
| XLogP | 4.15 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|