C15H25N3O4 — CID 99813858
tert-butyl N-[[(5R,6R)-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate (PubChem CID 99813858) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl N-[[(5R,6R)-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(5R,6R)-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 99813858 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl N-[[(5R,6R)-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-6-yl]methyl]carbamate |
| SMILES | CN1C(=O)N[C@@]2(CCCC[C@@H]2CNC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C15H25N3O4/c1-14(2,3)22-13(21)16-9-10-7-5-6-8-15(10)11(19)18(4)12(20)17-15/h10H,5-9H2,1-4H3,(H,16,21)(H,17,20)/t10-,15-/m1/s1 |
| InChIKey | JZEXWYRLXUWYTK-MEBBXXQBSA-N |
| XLogP | 1.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|