C20H22N2O4S — CID 998159
(E)-4-[[3-carbamoyl-5-methyl-4-(4-propan-2-ylphenyl)thiophen-2-yl]amino]-2-methyl-4-oxobut-2-enoic acid (PubChem CID 998159) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is (E)-4-[[3-carbamoyl-5-methyl-4-(4-propan-2-ylphenyl)thiophen-2-yl]amino]-2-methyl-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3-carbamoyl-5-methyl-4-(4-propan-2-ylphenyl)thiophen-2-yl]amino]-2-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 998159 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (E)-4-[[3-carbamoyl-5-methyl-4-(4-propan-2-ylphenyl)thiophen-2-yl]amino]-2-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C\C(=O)Nc1sc(C)c(-c2ccc(C(C)C)cc2)c1C(N)=O)C(=O)O |
| InChI | InChI=1S/C20H22N2O4S/c1-10(2)13-5-7-14(8-6-13)16-12(4)27-19(17(16)18(21)24)22-15(23)9-11(3)20(25)26/h5-10H,1-4H3,(H2,21,24)(H,22,23)(H,25,26)/b11-9+ |
| InChIKey | VWGPZCAHGILDMA-PKNBQFBNSA-N |
| XLogP | 3.92 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|