C20H21N3O2S — CID 99816123
(1S)-2-[(6-benzylsulfanylpyrazin-2-yl)amino]-1-(4-methoxyphenyl)ethanol (PubChem CID 99816123) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is (1S)-2-[(6-benzylsulfanylpyrazin-2-yl)amino]-1-(4-methoxyphenyl)ethanol.
| Compound Name | (1S)-2-[(6-benzylsulfanylpyrazin-2-yl)amino]-1-(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 99816123 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (1S)-2-[(6-benzylsulfanylpyrazin-2-yl)amino]-1-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc([C@H](O)CNc2cncc(SCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-25-17-9-7-16(8-10-17)18(24)11-22-19-12-21-13-20(23-19)26-14-15-5-3-2-4-6-15/h2-10,12-13,18,24H,11,14H2,1H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | GTXHODMUIWIYGK-GOSISDBHSA-N |
| XLogP | 3.92 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |