C17H23N3OS — CID 133389684
1-[(6-benzylsulfanylpyrazin-2-yl)amino]-3,3-dimethylbutan-2-ol (PubChem CID 133389684) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-[(6-benzylsulfanylpyrazin-2-yl)amino]-3,3-dimethylbutan-2-ol.
| Compound Name | 1-[(6-benzylsulfanylpyrazin-2-yl)amino]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 133389684 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1-[(6-benzylsulfanylpyrazin-2-yl)amino]-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)CNc1cncc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C17H23N3OS/c1-17(2,3)14(21)9-19-15-10-18-11-16(20-15)22-12-13-7-5-4-6-8-13/h4-8,10-11,14,21H,9,12H2,1-3H3,(H,19,20) |
| InChIKey | ZZEGZZSWZDOWKL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |