C15H17N3S — CID 133389133
6-benzylsulfanyl-N-(cyclopropylmethyl)pyrazin-2-amine (PubChem CID 133389133) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is 6-benzylsulfanyl-N-(cyclopropylmethyl)pyrazin-2-amine.
| Compound Name | 6-benzylsulfanyl-N-(cyclopropylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 133389133 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 6-benzylsulfanyl-N-(cyclopropylmethyl)pyrazin-2-amine |
| SMILES | c1ccc(CSc2cncc(NCC3CC3)n2)cc1 |
| InChI | InChI=1S/C15H17N3S/c1-2-4-13(5-3-1)11-19-15-10-16-9-14(18-15)17-8-12-6-7-12/h1-5,9-10,12H,6-8,11H2,(H,17,18) |
| InChIKey | FXOGLIYUXPGZDH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |