C14H14N2O2S2 — CID 154740570
3-(6-benzylsulfanylpyrazin-2-yl)sulfanylpropanoic acid (PubChem CID 154740570) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-(6-benzylsulfanylpyrazin-2-yl)sulfanylpropanoic acid.
| Compound Name | 3-(6-benzylsulfanylpyrazin-2-yl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 154740570 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-(6-benzylsulfanylpyrazin-2-yl)sulfanylpropanoic acid |
| SMILES | O=C(O)CCSc1cncc(SCc2ccccc2)n1 |
| InChI | InChI=1S/C14H14N2O2S2/c17-14(18)6-7-19-12-8-15-9-13(16-12)20-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H,17,18) |
| InChIKey | CDAZBCWRGITIPU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |