C20H31ClN4O — CID 99818022
3-[(3S)-1-(2-chlorophenyl)piperidin-3-yl]-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea (PubChem CID 99818022) has the molecular formula C20H31ClN4O and a molecular weight of 378.95 g/mol. Its IUPAC name is 3-[(3S)-1-(2-chlorophenyl)piperidin-3-yl]-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea.
| Compound Name | 3-[(3S)-1-(2-chlorophenyl)piperidin-3-yl]-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 99818022 |
| Molecular Formula | C20H31ClN4O |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[(3S)-1-(2-chlorophenyl)piperidin-3-yl]-1-methyl-1-[(1-methylpiperidin-4-yl)methyl]urea |
| SMILES | CN1CCC(CN(C)C(=O)N[C@H]2CCCN(c3ccccc3Cl)C2)CC1 |
| InChI | InChI=1S/C20H31ClN4O/c1-23-12-9-16(10-13-23)14-24(2)20(26)22-17-6-5-11-25(15-17)19-8-4-3-7-18(19)21/h3-4,7-8,16-17H,5-6,9-15H2,1-2H3,(H,22,26)/t17-/m0/s1 |
| InChIKey | DBEPDALKAQJYBB-KRWDZBQOSA-N |
| XLogP | 3.29 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |