C15H21N3O2 — CID 99818989
5-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3,4-dimethyl-1H-pyridazin-6-one (PubChem CID 99818989) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3,4-dimethyl-1H-pyridazin-6-one.
| Compound Name | 5-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3,4-dimethyl-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 99818989 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 5-[(3aR,7aR)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-3,4-dimethyl-1H-pyridazin-6-one |
| SMILES | Cc1n[nH]c(=O)c(C(=O)N2C[C@@H]3CCCC[C@H]3C2)c1C |
| InChI | InChI=1S/C15H21N3O2/c1-9-10(2)16-17-14(19)13(9)15(20)18-7-11-5-3-4-6-12(11)8-18/h11-12H,3-8H2,1-2H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | YAGIPHFTBKDARR-RYUDHWBXSA-N |
| XLogP | 1.65 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |