C17H19N3O2 — CID 154857691
3,4-dimethyl-5-(3-phenylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one (PubChem CID 154857691) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3,4-dimethyl-5-(3-phenylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one.
| Compound Name | 3,4-dimethyl-5-(3-phenylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 154857691 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3,4-dimethyl-5-(3-phenylpyrrolidine-1-carbonyl)-1H-pyridazin-6-one |
| SMILES | Cc1n[nH]c(=O)c(C(=O)N2CCC(c3ccccc3)C2)c1C |
| InChI | InChI=1S/C17H19N3O2/c1-11-12(2)18-19-16(21)15(11)17(22)20-9-8-14(10-20)13-6-4-3-5-7-13/h3-7,14H,8-10H2,1-2H3,(H,19,21) |
| InChIKey | NCJOFHUMZBEWGO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |