C13H16BrN3O — CID 99820499
(1S)-1-(2-bromo-4-methoxyphenyl)-N-(1H-pyrazol-5-ylmethyl)ethanamine (PubChem CID 99820499) has the molecular formula C13H16BrN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is (1S)-1-(2-bromo-4-methoxyphenyl)-N-(1H-pyrazol-5-ylmethyl)ethanamine.
| Compound Name | (1S)-1-(2-bromo-4-methoxyphenyl)-N-(1H-pyrazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 99820499 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | (1S)-1-(2-bromo-4-methoxyphenyl)-N-(1H-pyrazol-5-ylmethyl)ethanamine |
| SMILES | COc1ccc([C@H](C)NCc2ccn[nH]2)c(Br)c1 |
| InChI | InChI=1S/C13H16BrN3O/c1-9(15-8-10-5-6-16-17-10)12-4-3-11(18-2)7-13(12)14/h3-7,9,15H,8H2,1-2H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | KNPBFSAAAXXPIT-VIFPVBQESA-N |
| XLogP | 3.03 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |