C14H25NO2 — CID 99821509
[(1R,4S)-4-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 99821509) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is [(1R,4S)-4-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 99821509 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | [(1R,4S)-4-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | CC1(C)C[C@H](N[C@@H]2C=C[C@H](CO)C2)C(C)(C)O1 |
| InChI | InChI=1S/C14H25NO2/c1-13(2)8-12(14(3,4)17-13)15-11-6-5-10(7-11)9-16/h5-6,10-12,15-16H,7-9H2,1-4H3/t10-,11+,12-/m0/s1 |
| InChIKey | GNPQVBONRZOYSL-TUAOUCFPSA-N |
| XLogP | 1.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|