C12H23NO — CID 103925169
[(1R,4S)-4-(2-methylpentylamino)cyclopent-2-en-1-yl]methanol (PubChem CID 103925169) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is [(1R,4S)-4-(2-methylpentylamino)cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-(2-methylpentylamino)cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 103925169 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | [(1R,4S)-4-(2-methylpentylamino)cyclopent-2-en-1-yl]methanol |
| SMILES | CCCC(C)CN[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C12H23NO/c1-3-4-10(2)8-13-12-6-5-11(7-12)9-14/h5-6,10-14H,3-4,7-9H2,1-2H3/t10?,11-,12+/m0/s1 |
| InChIKey | BMIAPIZUZACUQU-GLXQMMQGSA-N |
| XLogP | 1.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|