C17H23N5 — CID 99821769
(1S)-1-cyclopropyl-2-pyridin-2-yl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine (PubChem CID 99821769) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is (1S)-1-cyclopropyl-2-pyridin-2-yl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine.
| Compound Name | (1S)-1-cyclopropyl-2-pyridin-2-yl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 99821769 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | (1S)-1-cyclopropyl-2-pyridin-2-yl-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)ethanamine |
| SMILES | c1ccc(C[C@H](NCc2nnc3n2CCCC3)C2CC2)nc1 |
| InChI | InChI=1S/C17H23N5/c1-3-9-18-14(5-1)11-15(13-7-8-13)19-12-17-21-20-16-6-2-4-10-22(16)17/h1,3,5,9,13,15,19H,2,4,6-8,10-12H2/t15-/m0/s1 |
| InChIKey | FLURAWJOBVQSEM-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |