C13H10F2N4O3 — CID 99824291
3-[[5-(2,4-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methylimidazolidine-2,4-dione (PubChem CID 99824291) has the molecular formula C13H10F2N4O3 and a molecular weight of 308.24 g/mol. Its IUPAC name is 3-[[5-(2,4-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-(2,4-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99824291 |
| Molecular Formula | C13H10F2N4O3 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3-[[5-(2,4-difluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(Cc2noc(-c3ccc(F)cc3F)n2)C1=O |
| InChI | InChI=1S/C13H10F2N4O3/c1-18-6-11(20)19(13(18)21)5-10-16-12(22-17-10)8-3-2-7(14)4-9(8)15/h2-4H,5-6H2,1H3 |
| InChIKey | YHBDRQZBTUCHEQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|