C16H21FN4 — CID 99824558
(6R)-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 99824558) has the molecular formula C16H21FN4 and a molecular weight of 288.37 g/mol. Its IUPAC name is (6R)-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 99824558 |
| Molecular Formula | C16H21FN4 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (6R)-N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cc1nc2n(n1)C[C@H](N[C@@H](C)Cc1ccccc1F)CC2 |
| InChI | InChI=1S/C16H21FN4/c1-11(9-13-5-3-4-6-15(13)17)18-14-7-8-16-19-12(2)20-21(16)10-14/h3-6,11,14,18H,7-10H2,1-2H3/t11-,14+/m0/s1 |
| InChIKey | JIOUUMKEPILJSQ-SMDDNHRTSA-N |
| XLogP | 2.26 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |