C19H29FN2O — CID 99824763
N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine (PubChem CID 99824763) has the molecular formula C19H29FN2O and a molecular weight of 320.45 g/mol. Its IUPAC name is N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine.
| Compound Name | N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 99824763 |
| Molecular Formula | C19H29FN2O |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-[(2S)-1-(2-fluorophenyl)propan-2-yl]-1-[[(3S)-oxolan-3-yl]methyl]piperidin-4-amine |
| SMILES | C[C@@H](Cc1ccccc1F)NC1CCN(C[C@@H]2CCOC2)CC1 |
| InChI | InChI=1S/C19H29FN2O/c1-15(12-17-4-2-3-5-19(17)20)21-18-6-9-22(10-7-18)13-16-8-11-23-14-16/h2-5,15-16,18,21H,6-14H2,1H3/t15-,16-/m0/s1 |
| InChIKey | ULQKLXBNQFWOSW-HOTGVXAUSA-N |
| XLogP | 2.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |