C15H19ClN4 — CID 99824859
(8S)-N-[(2S)-2-(3-chlorophenyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 99824859) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is (8S)-N-[(2S)-2-(3-chlorophenyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | (8S)-N-[(2S)-2-(3-chlorophenyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 99824859 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (8S)-N-[(2S)-2-(3-chlorophenyl)propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | C[C@H](CN[C@H]1CCCn2ncnc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN4/c1-11(12-4-2-5-13(16)8-12)9-17-14-6-3-7-20-15(14)18-10-19-20/h2,4-5,8,10-11,14,17H,3,6-7,9H2,1H3/t11-,14+/m1/s1 |
| InChIKey | LGBZOIAZSNBIPU-RISCZKNCSA-N |
| XLogP | 3.16 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |