C12H20N4 — CID 104582927
N-hex-5-en-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 104582927) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is N-hex-5-en-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | N-hex-5-en-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 104582927 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-hex-5-en-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | C=CCCC(C)NC1CCCn2ncnc21 |
| InChI | InChI=1S/C12H20N4/c1-3-4-6-10(2)15-11-7-5-8-16-12(11)13-9-14-16/h3,9-11,15H,1,4-8H2,2H3 |
| InChIKey | MWMNTNZSBNGDRR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|