C11H8F2N4O2S — CID 99826245
3,5-difluoro-N-[2-oxo-2-(thiadiazol-5-ylamino)ethyl]benzamide (PubChem CID 99826245) has the molecular formula C11H8F2N4O2S and a molecular weight of 298.27 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-oxo-2-(thiadiazol-5-ylamino)ethyl]benzamide.
| Compound Name | 3,5-difluoro-N-[2-oxo-2-(thiadiazol-5-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 99826245 |
| Molecular Formula | C11H8F2N4O2S |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3,5-difluoro-N-[2-oxo-2-(thiadiazol-5-ylamino)ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cc(F)cc(F)c1)Nc1cnns1 |
| InChI | InChI=1S/C11H8F2N4O2S/c12-7-1-6(2-8(13)3-7)11(19)14-4-9(18)16-10-5-15-17-20-10/h1-3,5H,4H2,(H,14,19)(H,16,18) |
| InChIKey | UYTRXUCNSBBRLY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |