C19H31N5 — CID 99827051
(3R)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]spiro[3.4]octan-3-amine (PubChem CID 99827051) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is (3R)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]spiro[3.4]octan-3-amine.
| Compound Name | (3R)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]spiro[3.4]octan-3-amine |
|---|---|
| PubChem CID | 99827051 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | (3R)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]spiro[3.4]octan-3-amine |
| SMILES | c1cnc(N2CCN(CCCN[C@@H]3CCC34CCCC4)CC2)nc1 |
| InChI | InChI=1S/C19H31N5/c1-2-7-19(6-1)8-5-17(19)20-11-4-12-23-13-15-24(16-14-23)18-21-9-3-10-22-18/h3,9-10,17,20H,1-2,4-8,11-16H2/t17-/m1/s1 |
| InChIKey | KPSJJINCSXNEJJ-QGZVFWFLSA-N |
| XLogP | 2.30 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|