C19H29N7 — CID 136539178
2-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 136539178) has the molecular formula C19H29N7 and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 2-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 136539178 |
| Molecular Formula | C19H29N7 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 2-methyl-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | Cn1cc2c(n1)CCCC2NCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H29N7/c1-24-15-16-17(5-2-6-18(16)23-24)20-9-4-10-25-11-13-26(14-12-25)19-21-7-3-8-22-19/h3,7-8,15,17,20H,2,4-6,9-14H2,1H3 |
| InChIKey | GAZRUKJFTDCGLG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|