C10H11BrF2N2O2 — CID 99827353
3-(5-bromo-2,4-difluorophenyl)-1-(2-hydroxyethyl)-1-methylurea (PubChem CID 99827353) has the molecular formula C10H11BrF2N2O2 and a molecular weight of 309.11 g/mol. Its IUPAC name is 3-(5-bromo-2,4-difluorophenyl)-1-(2-hydroxyethyl)-1-methylurea.
| Compound Name | 3-(5-bromo-2,4-difluorophenyl)-1-(2-hydroxyethyl)-1-methylurea |
|---|---|
| PubChem CID | 99827353 |
| Molecular Formula | C10H11BrF2N2O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 3-(5-bromo-2,4-difluorophenyl)-1-(2-hydroxyethyl)-1-methylurea |
| SMILES | CN(CCO)C(=O)Nc1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C10H11BrF2N2O2/c1-15(2-3-16)10(17)14-9-4-6(11)7(12)5-8(9)13/h4-5,16H,2-3H2,1H3,(H,14,17) |
| InChIKey | WYHNGIUNGBHGRD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|