C14H21NO3S — CID 99828595
N-(cyclohexylmethyl)-2-[(S)-(2-methylfuran-3-yl)sulfinyl]acetamide (PubChem CID 99828595) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[(S)-(2-methylfuran-3-yl)sulfinyl]acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[(S)-(2-methylfuran-3-yl)sulfinyl]acetamide |
|---|---|
| PubChem CID | 99828595 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[(S)-(2-methylfuran-3-yl)sulfinyl]acetamide |
| SMILES | Cc1occc1[S@@](=O)CC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C14H21NO3S/c1-11-13(7-8-18-11)19(17)10-14(16)15-9-12-5-3-2-4-6-12/h7-8,12H,2-6,9-10H2,1H3,(H,15,16)/t19-/m0/s1 |
| InChIKey | PRGIHTFMXSWLFC-IBGZPJMESA-N |
| XLogP | 2.39 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |