C15H19ClN2O3 — CID 99829007
1-(4-acetyl-3-chlorophenyl)-3-[(1R,3R)-3-methoxycyclopentyl]urea (PubChem CID 99829007) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 1-(4-acetyl-3-chlorophenyl)-3-[(1R,3R)-3-methoxycyclopentyl]urea.
| Compound Name | 1-(4-acetyl-3-chlorophenyl)-3-[(1R,3R)-3-methoxycyclopentyl]urea |
|---|---|
| PubChem CID | 99829007 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-(4-acetyl-3-chlorophenyl)-3-[(1R,3R)-3-methoxycyclopentyl]urea |
| SMILES | CO[C@@H]1CC[C@@H](NC(=O)Nc2ccc(C(C)=O)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-9(19)13-6-4-11(8-14(13)16)18-15(20)17-10-3-5-12(7-10)21-2/h4,6,8,10,12H,3,5,7H2,1-2H3,(H2,17,18,20)/t10-,12-/m1/s1 |
| InChIKey | YRBFGPCFDGGVJR-ZYHUDNBSSA-N |
| XLogP | 3.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |