About (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine
(3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine (PubChem CID 99829515) has the molecular formula C19H30N6
and a molecular weight of 342.49 g/mol. Its IUPAC name is (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine.
Molecular Properties
| Compound Name | (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine |
| PubChem CID | 99829515 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine |
| SMILES | CC(C)n1nnnc1CNC1[C@H](C)CN(Cc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C19H30N6/c1-14(2)25-18(21-22-23-25)10-20-19-15(3)11-24(12-16(19)4)13-17-8-6-5-7-9-17/h5-9,14-16,19-20H,10-13H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | LOMOJHHAWGZQQJ-HZPDHXFCSA-N |
| XLogP | 2.50 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine?
The IUPAC name of (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine (CID 99829515) is (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine.
What is the SMILES notation for (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine?
The canonical SMILES for (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine is CC(C)n1nnnc1CNC1[C@H](C)CN(Cc2ccccc2)C[C@H]1C.
What is the InChIKey of (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine?
The InChIKey is LOMOJHHAWGZQQJ-HZPDHXFCSA-N. The full InChI is InChI=1S/C19H30N6/c1-14(2)25-18(21-22-23-25)10-20-19-15(3)11-24(12-16(19)4)13-17-8-6-5-7-9-17/h5-9,14-16,19-20H,10-13H2,1-4H3/t15-,16-/m1/s1.
What are the key properties of (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine?
(3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine has a molecular weight of 342.49 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R)-1-benzyl-3,5-dimethyl-N-[(1-propan-2-yltetrazol-5-yl)methyl]piperidin-4-amine is sourced from PubChem (CID 99829515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).