C16H20N2O2S — CID 99835171
N-[(2R,3S)-2-benzyl-3-hydroxy-2-methylbutyl]-1,3-thiazole-4-carboxamide (PubChem CID 99835171) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[(2R,3S)-2-benzyl-3-hydroxy-2-methylbutyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2R,3S)-2-benzyl-3-hydroxy-2-methylbutyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 99835171 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(2R,3S)-2-benzyl-3-hydroxy-2-methylbutyl]-1,3-thiazole-4-carboxamide |
| SMILES | C[C@H](O)[C@@](C)(CNC(=O)c1cscn1)Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-12(19)16(2,8-13-6-4-3-5-7-13)10-17-15(20)14-9-21-11-18-14/h3-7,9,11-12,19H,8,10H2,1-2H3,(H,17,20)/t12-,16+/m0/s1 |
| InChIKey | LUXUXXBFDBMFBN-BLLLJJGKSA-N |
| XLogP | 2.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |