C12H13BrN2O3S — CID 99837738
N-[2-bromo-4-[methyl(prop-2-ynyl)sulfamoyl]phenyl]acetamide (PubChem CID 99837738) has the molecular formula C12H13BrN2O3S and a molecular weight of 345.22 g/mol. Its IUPAC name is N-[2-bromo-4-[methyl(prop-2-ynyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-bromo-4-[methyl(prop-2-ynyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 99837738 |
| Molecular Formula | C12H13BrN2O3S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | N-[2-bromo-4-[methyl(prop-2-ynyl)sulfamoyl]phenyl]acetamide |
| SMILES | C#CCN(C)S(=O)(=O)c1ccc(NC(C)=O)c(Br)c1 |
| InChI | InChI=1S/C12H13BrN2O3S/c1-4-7-15(3)19(17,18)10-5-6-12(11(13)8-10)14-9(2)16/h1,5-6,8H,7H2,2-3H3,(H,14,16) |
| InChIKey | LNIWDPHRCWXOPX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|