C15H14N4O4 — CID 99839177
4-[(1-ethylpyrazol-4-yl)oxymethyl]-2-(4-nitrophenyl)-1,3-oxazole (PubChem CID 99839177) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-[(1-ethylpyrazol-4-yl)oxymethyl]-2-(4-nitrophenyl)-1,3-oxazole.
| Compound Name | 4-[(1-ethylpyrazol-4-yl)oxymethyl]-2-(4-nitrophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 99839177 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-[(1-ethylpyrazol-4-yl)oxymethyl]-2-(4-nitrophenyl)-1,3-oxazole |
| SMILES | CCn1cc(OCc2coc(-c3ccc([N+](=O)[O-])cc3)n2)cn1 |
| InChI | InChI=1S/C15H14N4O4/c1-2-18-8-14(7-16-18)22-9-12-10-23-15(17-12)11-3-5-13(6-4-11)19(20)21/h3-8,10H,2,9H2,1H3 |
| InChIKey | DQOPBTBHVALYRZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|