C16H17N3O5 — CID 75392456
N-[[2-(4-nitrophenyl)-1,3-oxazol-4-yl]methoxy]cyclopentanecarboxamide (PubChem CID 75392456) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[[2-(4-nitrophenyl)-1,3-oxazol-4-yl]methoxy]cyclopentanecarboxamide.
| Compound Name | N-[[2-(4-nitrophenyl)-1,3-oxazol-4-yl]methoxy]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 75392456 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-[[2-(4-nitrophenyl)-1,3-oxazol-4-yl]methoxy]cyclopentanecarboxamide |
| SMILES | O=C(NOCc1coc(-c2ccc([N+](=O)[O-])cc2)n1)C1CCCC1 |
| InChI | InChI=1S/C16H17N3O5/c20-15(11-3-1-2-4-11)18-24-10-13-9-23-16(17-13)12-5-7-14(8-6-12)19(21)22/h5-9,11H,1-4,10H2,(H,18,20) |
| InChIKey | JOYHQIPVFCELHY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|