C18H12N2O7 — CID 18194096
(2-phenyl-1,3-oxazol-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate (PubChem CID 18194096) has the molecular formula C18H12N2O7 and a molecular weight of 368.30 g/mol. Its IUPAC name is (2-phenyl-1,3-oxazol-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate.
| Compound Name | (2-phenyl-1,3-oxazol-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18194096 |
| Molecular Formula | C18H12N2O7 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (2-phenyl-1,3-oxazol-4-yl)methyl 6-nitro-1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OCc1coc(-c2ccccc2)n1)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C18H12N2O7/c21-18(13-6-15-16(27-10-26-15)7-14(13)20(22)23)25-9-12-8-24-17(19-12)11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | RCUHDDVEPNJFBX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|