C19H22N2O3 — CID 99839643
1-(1,3-dihydro-2-benzofuran-5-yl)-3-[(2S)-2-ethoxy-2-phenylethyl]urea (PubChem CID 99839643) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[(2S)-2-ethoxy-2-phenylethyl]urea.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[(2S)-2-ethoxy-2-phenylethyl]urea |
|---|---|
| PubChem CID | 99839643 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-[(2S)-2-ethoxy-2-phenylethyl]urea |
| SMILES | CCO[C@H](CNC(=O)Nc1ccc2c(c1)COC2)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-24-18(14-6-4-3-5-7-14)11-20-19(22)21-17-9-8-15-12-23-13-16(15)10-17/h3-10,18H,2,11-13H2,1H3,(H2,20,21,22)/t18-/m1/s1 |
| InChIKey | KOBJAIAWFQPTMV-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |