C19H30N2O4 — CID 100767604
1-(1,3-dihydro-2-benzofuran-5-yl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea (PubChem CID 100767604) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea |
|---|---|
| PubChem CID | 100767604 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-3-(6,6-dimethoxy-2,2-dimethylhexyl)urea |
| SMILES | COC(CCCC(C)(C)CNC(=O)Nc1ccc2c(c1)COC2)OC |
| InChI | InChI=1S/C19H30N2O4/c1-19(2,9-5-6-17(23-3)24-4)13-20-18(22)21-16-8-7-14-11-25-12-15(14)10-16/h7-8,10,17H,5-6,9,11-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | DFOXUVKTUOZGFM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|