C16H14N2O3S — CID 99841990
3-[(1S)-1-(benzenesulfonyl)ethyl]-5-phenyl-1,2,4-oxadiazole (PubChem CID 99841990) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-[(1S)-1-(benzenesulfonyl)ethyl]-5-phenyl-1,2,4-oxadiazole.
| Compound Name | 3-[(1S)-1-(benzenesulfonyl)ethyl]-5-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99841990 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-[(1S)-1-(benzenesulfonyl)ethyl]-5-phenyl-1,2,4-oxadiazole |
| SMILES | C[C@@H](c1noc(-c2ccccc2)n1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3S/c1-12(22(19,20)14-10-6-3-7-11-14)15-17-16(21-18-15)13-8-4-2-5-9-13/h2-12H,1H3/t12-/m0/s1 |
| InChIKey | PNMGOXOBNUDKHE-LBPRGKRZSA-N |
| XLogP | 3.27 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |