About cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate
cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate (PubChem CID 99842691) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate |
| PubChem CID | 99842691 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@@H](NC(=O)N[C@H](C)Cc2cccs2)C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-10(8-13-4-3-7-21-13)16-15(19)17-12-6-5-11(9-12)14(18)20-2/h3-4,7,10-12H,5-6,8-9H2,1-2H3,(H2,16,17,19)/t10-,11+,12-/m1/s1 |
| InChIKey | ZOGBGXFHFDRHDP-GRYCIOLGSA-N |
| XLogP | 2.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate (CID 99842691) is cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate is COC(=O)[C@H]1CC[C@@H](NC(=O)N[C@H](C)Cc2cccs2)C1.
What is the InChIKey of cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate?
The InChIKey is ZOGBGXFHFDRHDP-GRYCIOLGSA-N. The full InChI is InChI=1S/C15H22N2O3S/c1-10(8-13-4-3-7-21-13)16-15(19)17-12-6-5-11(9-12)14(18)20-2/h3-4,7,10-12H,5-6,8-9H2,1-2H3,(H2,16,17,19)/t10-,11+,12-/m1/s1.
What are the key properties of cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate?
cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate has a molecular weight of 310.42 g/mol, XLogP of 2.32, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,3R)-3-[[(2R)-1-thiophen-2-ylpropan-2-yl]carbamoylamino]cyclopentane-1-carboxylate is sourced from PubChem (CID 99842691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).