C14H23NO3S — CID 99843042
(2R)-2-methoxy-N-[(1S)-1-(4-methylphenyl)propyl]propane-1-sulfonamide (PubChem CID 99843042) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is (2R)-2-methoxy-N-[(1S)-1-(4-methylphenyl)propyl]propane-1-sulfonamide.
| Compound Name | (2R)-2-methoxy-N-[(1S)-1-(4-methylphenyl)propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 99843042 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2R)-2-methoxy-N-[(1S)-1-(4-methylphenyl)propyl]propane-1-sulfonamide |
| SMILES | CC[C@H](NS(=O)(=O)C[C@@H](C)OC)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H23NO3S/c1-5-14(13-8-6-11(2)7-9-13)15-19(16,17)10-12(3)18-4/h6-9,12,14-15H,5,10H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | YLFCASFNRGGBMV-OCCSQVGLSA-N |
| XLogP | 2.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |