C35H41N3O6 — CID 99844955
[2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] (2S,4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate (PubChem CID 99844955) has the molecular formula C35H41N3O6 and a molecular weight of 599.73 g/mol. Its IUPAC name is [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] (2S,4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate.
| Compound Name | [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] (2S,4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 99844955 |
| Molecular Formula | C35H41N3O6 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.30 |
| IUPAC Name | [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]carbamoylamino]-2-oxoethyl] (2S,4E)-4-[(2,3-dimethoxyphenyl)methylidene]-2-methyl-2,3-dihydro-1H-acridine-9-carboxylate |
| SMILES | COc1cccc(/C=C2\C[C@H](C)Cc3c2nc2ccccc2c3C(=O)OCC(=O)NC(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)c1OC |
| InChI | InChI=1S/C35H41N3O6/c1-20-16-24(18-23-11-9-15-29(42-4)33(23)43-5)32-26(17-20)31(25-12-6-7-13-28(25)36-32)34(40)44-19-30(39)38-35(41)37-27-14-8-10-21(2)22(27)3/h6-7,9,11-13,15,18,20-22,27H,8,10,14,16-17,19H2,1-5H3,(H2,37,38,39,41)/b24-18+/t20-,21+,22-,27+/m0/s1 |
| InChIKey | ZSWADAOLKFTBNS-PSGWCBJASA-N |
| XLogP | 6.18 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |