C15H20FNO3 — CID 99847607
methyl (2R)-2-(2-fluorophenyl)-2-[(3S)-3-(2-hydroxyethyl)pyrrolidin-1-yl]acetate (PubChem CID 99847607) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is methyl (2R)-2-(2-fluorophenyl)-2-[(3S)-3-(2-hydroxyethyl)pyrrolidin-1-yl]acetate.
| Compound Name | methyl (2R)-2-(2-fluorophenyl)-2-[(3S)-3-(2-hydroxyethyl)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 99847607 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl (2R)-2-(2-fluorophenyl)-2-[(3S)-3-(2-hydroxyethyl)pyrrolidin-1-yl]acetate |
| SMILES | COC(=O)[C@@H](c1ccccc1F)N1CC[C@@H](CCO)C1 |
| InChI | InChI=1S/C15H20FNO3/c1-20-15(19)14(12-4-2-3-5-13(12)16)17-8-6-11(10-17)7-9-18/h2-5,11,14,18H,6-10H2,1H3/t11-,14+/m0/s1 |
| InChIKey | SDGLQXFBKMFULS-SMDDNHRTSA-N |
| XLogP | 1.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |