C18H29N5O2 — CID 99852891
(2R)-N-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide (PubChem CID 99852891) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (2R)-N-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide.
| Compound Name | (2R)-N-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 99852891 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (2R)-N-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-2-(1H-pyrazol-4-yl)piperidine-1-carboxamide |
| SMILES | O=C(NC[C@@H]1CN2CCCC[C@@H]2CO1)N1CCCC[C@@H]1c1cn[nH]c1 |
| InChI | InChI=1S/C18H29N5O2/c24-18(23-8-4-2-6-17(23)14-9-20-21-10-14)19-11-16-12-22-7-3-1-5-15(22)13-25-16/h9-10,15-17H,1-8,11-13H2,(H,19,24)(H,20,21)/t15-,16-,17-/m1/s1 |
| InChIKey | HVWVJSBYQIUUIB-BRWVUGGUSA-N |
| XLogP | 1.90 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |