C15H23N3O2 — CID 99853896
methyl (3aS,6aS)-2-[(2-ethylpyrazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate (PubChem CID 99853896) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is methyl (3aS,6aS)-2-[(2-ethylpyrazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-2-[(2-ethylpyrazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 99853896 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | methyl (3aS,6aS)-2-[(2-ethylpyrazol-3-yl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
| SMILES | CCn1nccc1CN1C[C@H]2CCC[C@@]2(C(=O)OC)C1 |
| InChI | InChI=1S/C15H23N3O2/c1-3-18-13(6-8-16-18)10-17-9-12-5-4-7-15(12,11-17)14(19)20-2/h6,8,12H,3-5,7,9-11H2,1-2H3/t12-,15-/m1/s1 |
| InChIKey | FQDGPIADCAUKGN-IUODEOHRSA-N |
| XLogP | 1.68 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |