C17H33N3O2S — CID 99856203
4-[[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]methyl]-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 99856203) has the molecular formula C17H33N3O2S and a molecular weight of 343.54 g/mol. Its IUPAC name is 4-[[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]methyl]-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | 4-[[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]methyl]-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 99856203 |
| Molecular Formula | C17H33N3O2S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-[[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]methyl]-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CNCC1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C17H33N3O2S/c1-14-6-5-7-15(2)17(14)13-18-12-16-8-10-20(11-9-16)23(21,22)19(3)4/h6,15-18H,5,7-13H2,1-4H3/t15-,17+/m0/s1 |
| InChIKey | FOSMQMDCJSTQAY-DOTOQJQBSA-N |
| XLogP | 2.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|