C14H27NO2S — CID 100662419
N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-ethylsulfonyl-N-methylethanamine (PubChem CID 100662419) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-ethylsulfonyl-N-methylethanamine.
| Compound Name | N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-ethylsulfonyl-N-methylethanamine |
|---|---|
| PubChem CID | 100662419 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-2-ethylsulfonyl-N-methylethanamine |
| SMILES | CCS(=O)(=O)CCN(C)C[C@@H]1C(C)=CCC[C@@H]1C |
| InChI | InChI=1S/C14H27NO2S/c1-5-18(16,17)10-9-15(4)11-14-12(2)7-6-8-13(14)3/h7,13-14H,5-6,8-11H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | HSTDGJMOSMHHIW-UONOGXRCSA-N |
| XLogP | 2.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|