C15H26N2O2 — CID 129429790
(2R,6R)-4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-6-methylmorpholine-2-carboxamide (PubChem CID 129429790) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2R,6R)-4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-6-methylmorpholine-2-carboxamide.
| Compound Name | (2R,6R)-4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-6-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 129429790 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (2R,6R)-4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-6-methylmorpholine-2-carboxamide |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN1C[C@@H](C)O[C@@H](C(N)=O)C1 |
| InChI | InChI=1S/C15H26N2O2/c1-10-5-4-6-11(2)13(10)8-17-7-12(3)19-14(9-17)15(16)18/h5,11-14H,4,6-9H2,1-3H3,(H2,16,18)/t11-,12+,13+,14+/m0/s1 |
| InChIKey | PMKCMSBMXOZEQH-REWJHTLYSA-N |
| XLogP | 1.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|