C15H27N3O — CID 129401310
4-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,4-diazepane-1-carboxamide (PubChem CID 129401310) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 129401310 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 4-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC1=CCC[C@@H](C)[C@@H]1CN1CCCN(C(N)=O)CC1 |
| InChI | InChI=1S/C15H27N3O/c1-12-5-3-6-13(2)14(12)11-17-7-4-8-18(10-9-17)15(16)19/h5,13-14H,3-4,6-11H2,1-2H3,(H2,16,19)/t13-,14-/m1/s1 |
| InChIKey | WCPGXNJBIHHPCZ-ZIAGYGMSSA-N |
| XLogP | 2.07 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|